C20H14N6O6S2 — CID 54010032
4-[2-(4-sulfophenyl)-1,2-bis(1,3,5-triazin-2-yl)ethenyl]benzenesulfonic acid (PubChem CID 54010032) has the molecular formula C20H14N6O6S2 and a molecular weight of 498.50 g/mol. Its IUPAC name is 4-[2-(4-sulfophenyl)-1,2-bis(1,3,5-triazin-2-yl)ethenyl]benzenesulfonic acid.
| Compound Name | 4-[2-(4-sulfophenyl)-1,2-bis(1,3,5-triazin-2-yl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54010032 |
| Molecular Formula | C20H14N6O6S2 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 4-[2-(4-sulfophenyl)-1,2-bis(1,3,5-triazin-2-yl)ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C(=C(c2ccc(S(=O)(=O)O)cc2)c2ncncn2)c2ncncn2)cc1 |
| InChI | InChI=1S/C20H14N6O6S2/c27-33(28,29)15-5-1-13(2-6-15)17(19-23-9-21-10-24-19)18(20-25-11-22-12-26-20)14-3-7-16(8-4-14)34(30,31)32/h1-12H,(H,27,28,29)(H,30,31,32) |
| InChIKey | KRRBTUHCQMYFSG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 186.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|