C20H29FO5 — CID 54010119
(1R)-1-[(3aR,5R,6S,6aR)-6-[(2-butyl-3-fluorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol (PubChem CID 54010119) has the molecular formula C20H29FO5 and a molecular weight of 368.45 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-butyl-3-fluorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-butyl-3-fluorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
|---|---|
| PubChem CID | 54010119 |
| Molecular Formula | C20H29FO5 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(2-butyl-3-fluorophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanol |
| SMILES | CCCCc1c(F)cccc1CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H](C)O |
| InChI | InChI=1S/C20H29FO5/c1-5-6-9-14-13(8-7-10-15(14)21)11-23-17-16(12(2)22)24-19-18(17)25-20(3,4)26-19/h7-8,10,12,16-19,22H,5-6,9,11H2,1-4H3/t12-,16-,17+,18-,19-/m1/s1 |
| InChIKey | KRSQUHKSUMWKSN-DCCCRPSOSA-N |
| XLogP | 3.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |