About 5-methoxycarbonylhexa-2,5-dienoic acid
5-methoxycarbonylhexa-2,5-dienoic acid (PubChem CID 54010254) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 5-methoxycarbonylhexa-2,5-dienoic acid.
Molecular Properties
| Compound Name | 5-methoxycarbonylhexa-2,5-dienoic acid |
| PubChem CID | 54010254 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5-methoxycarbonylhexa-2,5-dienoic acid |
| SMILES | C=C(CC=CC(=O)O)C(=O)OC |
| InChI | InChI=1S/C8H10O4/c1-6(8(11)12-2)4-3-5-7(9)10/h3,5H,1,4H2,2H3,(H,9,10) |
| InChIKey | KRVFWHOOGMXUIU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxycarbonylhexa-2,5-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxycarbonylhexa-2,5-dienoic acid?
The IUPAC name of 5-methoxycarbonylhexa-2,5-dienoic acid (CID 54010254) is 5-methoxycarbonylhexa-2,5-dienoic acid.
What is the SMILES notation for 5-methoxycarbonylhexa-2,5-dienoic acid?
The canonical SMILES for 5-methoxycarbonylhexa-2,5-dienoic acid is C=C(CC=CC(=O)O)C(=O)OC.
What is the InChIKey of 5-methoxycarbonylhexa-2,5-dienoic acid?
The InChIKey is KRVFWHOOGMXUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-6(8(11)12-2)4-3-5-7(9)10/h3,5H,1,4H2,2H3,(H,9,10).
What are the key properties of 5-methoxycarbonylhexa-2,5-dienoic acid?
5-methoxycarbonylhexa-2,5-dienoic acid has a molecular weight of 170.16 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxycarbonylhexa-2,5-dienoic acid is sourced from PubChem (CID 54010254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).