About 6-methyloctanenitrile
6-methyloctanenitrile (PubChem CID 54010622) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 6-methyloctanenitrile.
Molecular Properties
| Compound Name | 6-methyloctanenitrile |
| PubChem CID | 54010622 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 6-methyloctanenitrile |
| SMILES | CCC(C)CCCCC#N |
| InChI | InChI=1S/C9H17N/c1-3-9(2)7-5-4-6-8-10/h9H,3-7H2,1-2H3 |
| InChIKey | SBWUTDAAHYBNLR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyloctanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyloctanenitrile?
The IUPAC name of 6-methyloctanenitrile (CID 54010622) is 6-methyloctanenitrile.
What is the SMILES notation for 6-methyloctanenitrile?
The canonical SMILES for 6-methyloctanenitrile is CCC(C)CCCCC#N.
What is the InChIKey of 6-methyloctanenitrile?
The InChIKey is SBWUTDAAHYBNLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-3-9(2)7-5-4-6-8-10/h9H,3-7H2,1-2H3.
What are the key properties of 6-methyloctanenitrile?
6-methyloctanenitrile has a molecular weight of 139.24 g/mol, XLogP of 3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyloctanenitrile is sourced from PubChem (CID 54010622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).