C26H20ClF3N2O4 — CID 54011183
2-[4-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 54011183) has the molecular formula C26H20ClF3N2O4 and a molecular weight of 516.90 g/mol. Its IUPAC name is 2-[4-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54011183 |
| Molecular Formula | C26H20ClF3N2O4 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 2-[4-[6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCN1C(=O)OC(C#CC2CC2)(C(F)(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H20ClF3N2O4/c27-17-9-10-21-20(15-17)25(26(28,29)30,12-11-16-7-8-16)36-24(35)31(21)13-3-4-14-32-22(33)18-5-1-2-6-19(18)23(32)34/h1-2,5-6,9-10,15-16H,3-4,7-8,13-14H2 |
| InChIKey | KSLQDHQXPQMQBK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|