C7H5F7O — CID 54011523
4,4,5,5,6,6,6-heptafluoro-2-methylhex-2-enal (PubChem CID 54011523) has the molecular formula C7H5F7O and a molecular weight of 238.10 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-2-methylhex-2-enal.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-2-methylhex-2-enal |
|---|---|
| PubChem CID | 54011523 |
| Molecular Formula | C7H5F7O |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-methylhex-2-enal |
| SMILES | CC(C=O)=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F7O/c1-4(3-15)2-5(8,9)6(10,11)7(12,13)14/h2-3H,1H3 |
| InChIKey | KSRXQBZQEYGSSC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|