C44H78N14 — CID 54011673
6-[4-[4,6-bis(3-piperidin-1-ylpropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-2-N,4-N-bis(3-piperidin-1-ylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 54011673) has the molecular formula C44H78N14 and a molecular weight of 803.21 g/mol. Its IUPAC name is 6-[4-[4,6-bis(3-piperidin-1-ylpropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-2-N,4-N-bis(3-piperidin-1-ylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-[4,6-bis(3-piperidin-1-ylpropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-2-N,4-N-bis(3-piperidin-1-ylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 54011673 |
| Molecular Formula | C44H78N14 |
| Molecular Weight | 803.21 g/mol |
| Exact Mass | 802.65 |
| IUPAC Name | 6-[4-[4,6-bis(3-piperidin-1-ylpropylamino)-1,3,5-triazin-2-yl]cyclohexyl]-2-N,4-N-bis(3-piperidin-1-ylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C1CCN(CCCNc2nc(NCCCN3CCCCC3)nc(C3CCC(c4nc(NCCCN5CCCCC5)nc(NCCCN5CCCCC5)n4)CC3)n2)CC1 |
| InChI | InChI=1S/C44H78N14/c1-5-25-55(26-6-1)33-13-21-45-41-49-39(50-42(53-41)46-22-14-34-56-27-7-2-8-28-56)37-17-19-38(20-18-37)40-51-43(47-23-15-35-57-29-9-3-10-30-57)54-44(52-40)48-24-16-36-58-31-11-4-12-32-58/h37-38H,1-36H2,(H2,45,46,49,50,53)(H2,47,48,51,52,54) |
| InChIKey | KSUKSNNCUUBCSC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.21 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|