About 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide
1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide (PubChem CID 54011891) has the molecular formula C9H13NO5S
and a molecular weight of 247.27 g/mol. Its IUPAC name is 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide.
Molecular Properties
| Compound Name | 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide |
| PubChem CID | 54011891 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide |
| SMILES | CNCOc1ccc(COO)cc1.O=S=O |
| InChI | InChI=1S/C9H13NO3.O2S/c1-10-7-12-9-4-2-8(3-5-9)6-13-11;1-3-2/h2-5,10-11H,6-7H2,1H3; |
| InChIKey | KSYAGYPWQWWHFD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide?
The IUPAC name of 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide (CID 54011891) is 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide.
What is the SMILES notation for 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide?
The canonical SMILES for 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide is CNCOc1ccc(COO)cc1.O=S=O.
What is the InChIKey of 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide?
The InChIKey is KSYAGYPWQWWHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3.O2S/c1-10-7-12-9-4-2-8(3-5-9)6-13-11;1-3-2/h2-5,10-11H,6-7H2,1H3;.
What are the key properties of 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide?
1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide has a molecular weight of 247.27 g/mol, XLogP of 0.56, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(hydroperoxymethyl)phenoxy]-N-methylmethanamine;sulfur dioxide is sourced from PubChem (CID 54011891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).