C7H8N2S — CID 54012176
1,3,3a,7a-tetrahydrobenzimidazole-2-thione (PubChem CID 54012176) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 1,3,3a,7a-tetrahydrobenzimidazole-2-thione.
| Compound Name | 1,3,3a,7a-tetrahydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 54012176 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 1,3,3a,7a-tetrahydrobenzimidazole-2-thione |
| SMILES | S=C1NC2C=CC=CC2N1 |
| InChI | InChI=1S/C7H8N2S/c10-7-8-5-3-1-2-4-6(5)9-7/h1-6H,(H2,8,9,10) |
| InChIKey | KTCQYJJYMDJOHE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|