About (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate
(2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate (PubChem CID 54012326) has the molecular formula C12H10ClNO5
and a molecular weight of 283.67 g/mol. Its IUPAC name is (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate |
| PubChem CID | 54012326 |
| Molecular Formula | C12H10ClNO5 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate |
| SMILES | O=C(OCc1ccccc1Cl)On1c(O)ccc1O |
| InChI | InChI=1S/C12H10ClNO5/c13-9-4-2-1-3-8(9)7-18-12(17)19-14-10(15)5-6-11(14)16/h1-6,15-16H,7H2 |
| InChIKey | KTFITINRQRRUOY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate?
The IUPAC name of (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate (CID 54012326) is (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate.
What is the SMILES notation for (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate?
The canonical SMILES for (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate is O=C(OCc1ccccc1Cl)On1c(O)ccc1O.
What is the InChIKey of (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate?
The InChIKey is KTFITINRQRRUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO5/c13-9-4-2-1-3-8(9)7-18-12(17)19-14-10(15)5-6-11(14)16/h1-6,15-16H,7H2.
What are the key properties of (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate?
(2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate has a molecular weight of 283.67 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl (2,5-dihydroxypyrrol-1-yl) carbonate is sourced from PubChem (CID 54012326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).