About 2-methylcyclohex-3-ene-1,2-dicarbaldehyde
2-methylcyclohex-3-ene-1,2-dicarbaldehyde (PubChem CID 54012378) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-methylcyclohex-3-ene-1,2-dicarbaldehyde.
Molecular Properties
| Compound Name | 2-methylcyclohex-3-ene-1,2-dicarbaldehyde |
| PubChem CID | 54012378 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-methylcyclohex-3-ene-1,2-dicarbaldehyde |
| SMILES | CC1(C=O)C=CCCC1C=O |
| InChI | InChI=1S/C9H12O2/c1-9(7-11)5-3-2-4-8(9)6-10/h3,5-8H,2,4H2,1H3 |
| InChIKey | BXUODJCUZLXTHJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylcyclohex-3-ene-1,2-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclohex-3-ene-1,2-dicarbaldehyde?
The IUPAC name of 2-methylcyclohex-3-ene-1,2-dicarbaldehyde (CID 54012378) is 2-methylcyclohex-3-ene-1,2-dicarbaldehyde.
What is the SMILES notation for 2-methylcyclohex-3-ene-1,2-dicarbaldehyde?
The canonical SMILES for 2-methylcyclohex-3-ene-1,2-dicarbaldehyde is CC1(C=O)C=CCCC1C=O.
What is the InChIKey of 2-methylcyclohex-3-ene-1,2-dicarbaldehyde?
The InChIKey is BXUODJCUZLXTHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-9(7-11)5-3-2-4-8(9)6-10/h3,5-8H,2,4H2,1H3.
What are the key properties of 2-methylcyclohex-3-ene-1,2-dicarbaldehyde?
2-methylcyclohex-3-ene-1,2-dicarbaldehyde has a molecular weight of 152.19 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclohex-3-ene-1,2-dicarbaldehyde is sourced from PubChem (CID 54012378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).