C8H14N2O — CID 54012474
2-[(2R)-4-methoxy-1-methylpyrrolidin-2-yl]acetonitrile (PubChem CID 54012474) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-[(2R)-4-methoxy-1-methylpyrrolidin-2-yl]acetonitrile.
| Compound Name | 2-[(2R)-4-methoxy-1-methylpyrrolidin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 54012474 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-[(2R)-4-methoxy-1-methylpyrrolidin-2-yl]acetonitrile |
| SMILES | COC1C[C@@H](CC#N)N(C)C1 |
| InChI | InChI=1S/C8H14N2O/c1-10-6-8(11-2)5-7(10)3-4-9/h7-8H,3,5-6H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | KTHTUGIJQJICAR-GVHYBUMESA-N |
| XLogP | 0.62 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |