About O-but-1-enyl ethanethioate
O-but-1-enyl ethanethioate (PubChem CID 54012499) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is O-but-1-enyl ethanethioate.
Molecular Properties
| Compound Name | O-but-1-enyl ethanethioate |
| PubChem CID | 54012499 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | O-but-1-enyl ethanethioate |
| SMILES | CCC=COC(C)=S |
| InChI | InChI=1S/C6H10OS/c1-3-4-5-7-6(2)8/h4-5H,3H2,1-2H3 |
| InChIKey | KTIFNUGDZKEVTN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-but-1-enyl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-but-1-enyl ethanethioate?
The IUPAC name of O-but-1-enyl ethanethioate (CID 54012499) is O-but-1-enyl ethanethioate.
What is the SMILES notation for O-but-1-enyl ethanethioate?
The canonical SMILES for O-but-1-enyl ethanethioate is CCC=COC(C)=S.
What is the InChIKey of O-but-1-enyl ethanethioate?
The InChIKey is KTIFNUGDZKEVTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-3-4-5-7-6(2)8/h4-5H,3H2,1-2H3.
What are the key properties of O-but-1-enyl ethanethioate?
O-but-1-enyl ethanethioate has a molecular weight of 130.21 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-but-1-enyl ethanethioate is sourced from PubChem (CID 54012499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).