C20H23N5O9S2 — CID 54012552
(6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54012552) has the molecular formula C20H23N5O9S2 and a molecular weight of 541.56 g/mol. Its IUPAC name is (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54012552 |
| Molecular Formula | C20H23N5O9S2 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COCCON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(COC(=O)CC(C)=O)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C20H23N5O9S2/c1-9(26)5-12(27)33-6-10-7-35-18-14(17(29)25(18)15(10)19(30)31)23-16(28)13(24-34-4-3-32-2)11-8-36-20(21)22-11/h8,14,18H,3-7H2,1-2H3,(H2,21,22)(H,23,28)(H,30,31)/t14-,18+/m1/s1 |
| InChIKey | KTJLGXBVVSQYJL-KDOFPFPSSA-N |
| XLogP | -0.65 |
| TPSA | 199.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|