About 3-N,4-dimethylbenzene-1,2,3-triamine
3-N,4-dimethylbenzene-1,2,3-triamine (PubChem CID 54012745) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-N,4-dimethylbenzene-1,2,3-triamine.
Molecular Properties
| Compound Name | 3-N,4-dimethylbenzene-1,2,3-triamine |
| PubChem CID | 54012745 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3-N,4-dimethylbenzene-1,2,3-triamine |
| SMILES | CNc1c(C)ccc(N)c1N |
| InChI | InChI=1S/C8H13N3/c1-5-3-4-6(9)7(10)8(5)11-2/h3-4,11H,9-10H2,1-2H3 |
| InChIKey | KTNFKDJRPNICKZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N,4-dimethylbenzene-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,4-dimethylbenzene-1,2,3-triamine?
The IUPAC name of 3-N,4-dimethylbenzene-1,2,3-triamine (CID 54012745) is 3-N,4-dimethylbenzene-1,2,3-triamine.
What is the SMILES notation for 3-N,4-dimethylbenzene-1,2,3-triamine?
The canonical SMILES for 3-N,4-dimethylbenzene-1,2,3-triamine is CNc1c(C)ccc(N)c1N.
What is the InChIKey of 3-N,4-dimethylbenzene-1,2,3-triamine?
The InChIKey is KTNFKDJRPNICKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-5-3-4-6(9)7(10)8(5)11-2/h3-4,11H,9-10H2,1-2H3.
What are the key properties of 3-N,4-dimethylbenzene-1,2,3-triamine?
3-N,4-dimethylbenzene-1,2,3-triamine has a molecular weight of 151.21 g/mol, XLogP of 1.20, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,4-dimethylbenzene-1,2,3-triamine is sourced from PubChem (CID 54012745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).