C18H30N8S4 — CID 54013020
1-[3-[[amino-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 54013020) has the molecular formula C18H30N8S4 and a molecular weight of 486.76 g/mol. Its IUPAC name is 1-[3-[[amino-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-[3-[[amino-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 54013020 |
| Molecular Formula | C18H30N8S4 |
| Molecular Weight | 486.76 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[3-[[amino-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | Cc1[nH]cnc1CSCCN/C(N)=N/CCCNC(=S)NCCSCc1nccs1 |
| InChI | InChI=1S/C18H30N8S4/c1-14-15(26-13-25-14)11-28-8-5-22-17(19)21-3-2-4-23-18(27)24-6-9-29-12-16-20-7-10-30-16/h7,10,13H,2-6,8-9,11-12H2,1H3,(H,25,26)(H3,19,21,22)(H2,23,24,27) |
| InChIKey | KTRYLLZQUGHSEV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|