About (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate
(2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate (PubChem CID 54013041) has the molecular formula C14H18ClNO6S
and a molecular weight of 363.82 g/mol. Its IUPAC name is (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate.
Molecular Properties
| Compound Name | (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate |
| PubChem CID | 54013041 |
| Molecular Formula | C14H18ClNO6S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate |
| SMILES | COC1Oc2ccc(OS(=O)(=O)N(Cl)CC(C)=O)cc2C1(C)C |
| InChI | InChI=1S/C14H18ClNO6S/c1-9(17)8-16(15)23(18,19)22-10-5-6-12-11(7-10)14(2,3)13(20-4)21-12/h5-7,13H,8H2,1-4H3 |
| InChIKey | KTSHGUIUMQWPOS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate?
The IUPAC name of (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate (CID 54013041) is (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate.
What is the SMILES notation for (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate?
The canonical SMILES for (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate is COC1Oc2ccc(OS(=O)(=O)N(Cl)CC(C)=O)cc2C1(C)C.
What is the InChIKey of (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate?
The InChIKey is KTSHGUIUMQWPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO6S/c1-9(17)8-16(15)23(18,19)22-10-5-6-12-11(7-10)14(2,3)13(20-4)21-12/h5-7,13H,8H2,1-4H3.
What are the key properties of (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate?
(2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate has a molecular weight of 363.82 g/mol, XLogP of 2.00, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) N-chloro-N-(2-oxopropyl)sulfamate is sourced from PubChem (CID 54013041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).