C22H21F2N5O2S — CID 54013762
N-[1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidin-4-yl]formamide (PubChem CID 54013762) has the molecular formula C22H21F2N5O2S and a molecular weight of 457.51 g/mol. Its IUPAC name is N-[1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidin-4-yl]formamide.
| Compound Name | N-[1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidin-4-yl]formamide |
|---|---|
| PubChem CID | 54013762 |
| Molecular Formula | C22H21F2N5O2S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-[1-[4-[[4-amino-5-(2,6-difluorobenzoyl)-1,3-thiazol-2-yl]amino]phenyl]piperidin-4-yl]formamide |
| SMILES | Nc1nc(Nc2ccc(N3CCC(NC=O)CC3)cc2)sc1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C22H21F2N5O2S/c23-16-2-1-3-17(24)18(16)19(31)20-21(25)28-22(32-20)27-14-4-6-15(7-5-14)29-10-8-13(9-11-29)26-12-30/h1-7,12-13H,8-11,25H2,(H,26,30)(H,27,28) |
| InChIKey | KUEAQELZKROPLU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|