About octadec-9-enylthiourea
octadec-9-enylthiourea (PubChem CID 54013797) has the molecular formula C19H38N2S
and a molecular weight of 326.59 g/mol. Its IUPAC name is octadec-9-enylthiourea.
Molecular Properties
| Compound Name | octadec-9-enylthiourea |
| PubChem CID | 54013797 |
| Molecular Formula | C19H38N2S |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | octadec-9-enylthiourea |
| SMILES | CCCCCCCCC=CCCCCCCCCNC(N)=S |
| InChI | InChI=1S/C19H38N2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)22/h9-10H,2-8,11-18H2,1H3,(H3,20,21,22) |
| InChIKey | KUEQRJMMNUDSQY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze octadec-9-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-9-enylthiourea?
The IUPAC name of octadec-9-enylthiourea (CID 54013797) is octadec-9-enylthiourea.
What is the SMILES notation for octadec-9-enylthiourea?
The canonical SMILES for octadec-9-enylthiourea is CCCCCCCCC=CCCCCCCCCNC(N)=S.
What is the InChIKey of octadec-9-enylthiourea?
The InChIKey is KUEQRJMMNUDSQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)22/h9-10H,2-8,11-18H2,1H3,(H3,20,21,22).
What are the key properties of octadec-9-enylthiourea?
octadec-9-enylthiourea has a molecular weight of 326.59 g/mol, XLogP of 5.86, 16 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-9-enylthiourea is sourced from PubChem (CID 54013797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).