C13H7F6NO3 — CID 54014002
N-(5-oxo-2H-furan-3-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 54014002) has the molecular formula C13H7F6NO3 and a molecular weight of 339.19 g/mol. Its IUPAC name is N-(5-oxo-2H-furan-3-yl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(5-oxo-2H-furan-3-yl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 54014002 |
| Molecular Formula | C13H7F6NO3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-(5-oxo-2H-furan-3-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C1C=C(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CO1 |
| InChI | InChI=1S/C13H7F6NO3/c14-12(15,16)7-1-6(2-8(3-7)13(17,18)19)11(22)20-9-4-10(21)23-5-9/h1-4H,5H2,(H,20,22) |
| InChIKey | KUIMURSRJPHDPH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |