C15H32O3 — CID 54014170
1,1,1-trimethoxy-7,7,8-trimethylnonane (PubChem CID 54014170) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is 1,1,1-trimethoxy-7,7,8-trimethylnonane.
| Compound Name | 1,1,1-trimethoxy-7,7,8-trimethylnonane |
|---|---|
| PubChem CID | 54014170 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 1,1,1-trimethoxy-7,7,8-trimethylnonane |
| SMILES | COC(CCCCCC(C)(C)C(C)C)(OC)OC |
| InChI | InChI=1S/C15H32O3/c1-13(2)14(3,4)11-9-8-10-12-15(16-5,17-6)18-7/h13H,8-12H2,1-7H3 |
| InChIKey | IGGJEFNOUDVVAE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|