About N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide
N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 54014302) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide |
| PubChem CID | 54014302 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C15H25NO/c1-12(2)10-16(11-13(3)4)15(17)14-8-6-5-7-9-14/h5-6,8,12-13H,7,9-11H2,1-4H3 |
| InChIKey | HLWXKHLCNQVJAY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide?
The IUPAC name of N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide (CID 54014302) is N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide.
What is the SMILES notation for N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide?
The canonical SMILES for N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide is CC(C)CN(CC(C)C)C(=O)C1=CC=CCC1.
What is the InChIKey of N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide?
The InChIKey is HLWXKHLCNQVJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-12(2)10-16(11-13(3)4)15(17)14-8-6-5-7-9-14/h5-6,8,12-13H,7,9-11H2,1-4H3.
What are the key properties of N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide?
N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide has a molecular weight of 235.37 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-methylpropyl)cyclohexa-1,3-diene-1-carboxamide is sourced from PubChem (CID 54014302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).