About 2-fluoro-4-methylsulfanyl-1,3,5-triazine
2-fluoro-4-methylsulfanyl-1,3,5-triazine (PubChem CID 54014626) has the molecular formula C4H4FN3S
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-fluoro-4-methylsulfanyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-fluoro-4-methylsulfanyl-1,3,5-triazine |
| PubChem CID | 54014626 |
| Molecular Formula | C4H4FN3S |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.01 |
| IUPAC Name | 2-fluoro-4-methylsulfanyl-1,3,5-triazine |
| SMILES | CSc1ncnc(F)n1 |
| InChI | InChI=1S/C4H4FN3S/c1-9-4-7-2-6-3(5)8-4/h2H,1H3 |
| InChIKey | BDJKYKIAQAYMEZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-4-methylsulfanyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methylsulfanyl-1,3,5-triazine?
The IUPAC name of 2-fluoro-4-methylsulfanyl-1,3,5-triazine (CID 54014626) is 2-fluoro-4-methylsulfanyl-1,3,5-triazine.
What is the SMILES notation for 2-fluoro-4-methylsulfanyl-1,3,5-triazine?
The canonical SMILES for 2-fluoro-4-methylsulfanyl-1,3,5-triazine is CSc1ncnc(F)n1.
What is the InChIKey of 2-fluoro-4-methylsulfanyl-1,3,5-triazine?
The InChIKey is BDJKYKIAQAYMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4FN3S/c1-9-4-7-2-6-3(5)8-4/h2H,1H3.
What are the key properties of 2-fluoro-4-methylsulfanyl-1,3,5-triazine?
2-fluoro-4-methylsulfanyl-1,3,5-triazine has a molecular weight of 145.16 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methylsulfanyl-1,3,5-triazine is sourced from PubChem (CID 54014626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).