C20H22O6 — CID 54015113
(3R,6S)-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione (PubChem CID 54015113) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (3R,6S)-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione.
| Compound Name | (3R,6S)-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione |
|---|---|
| PubChem CID | 54015113 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (3R,6S)-2,3,6,7-tetrahydroxy-1,8-diphenyloctane-4,5-dione |
| SMILES | O=C(C(=O)[C@H](O)C(O)Cc1ccccc1)[C@@H](O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H22O6/c21-15(11-13-7-3-1-4-8-13)17(23)19(25)20(26)18(24)16(22)12-14-9-5-2-6-10-14/h1-10,15-18,21-24H,11-12H2/t15?,16?,17-,18+ |
| InChIKey | KVBURMJFRIZQPL-OWCVQMPJSA-N |
| XLogP | 0.05 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|