C17H26O4 — CID 54015373
[5-[(1R,4R,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-en-4-ynyl] acetate (PubChem CID 54015373) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [5-[(1R,4R,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-en-4-ynyl] acetate.
| Compound Name | [5-[(1R,4R,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-en-4-ynyl] acetate |
|---|---|
| PubChem CID | 54015373 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [5-[(1R,4R,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-en-4-ynyl] acetate |
| SMILES | CC(=O)OCC=C(C)C#C[C@@]1(O)[C@H](C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C17H26O4/c1-12(7-9-21-14(3)18)6-8-17(20)13(2)10-15(19)11-16(17,4)5/h7,13,15,19-20H,9-11H2,1-5H3/t13-,15-,17-/m1/s1 |
| InChIKey | KVGOKFPNLVGFBP-FRFSOERESA-N |
| XLogP | 2.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|