C31H46O2 — CID 54015757
4-[[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methylidene]-2-methyl-6-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,5-dien-1-one (PubChem CID 54015757) has the molecular formula C31H46O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 4-[[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methylidene]-2-methyl-6-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,5-dien-1-one.
| Compound Name | 4-[[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methylidene]-2-methyl-6-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 54015757 |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | 4-[[4-hydroxy-3-methyl-5-(2,4,4-trimethylpentan-2-yl)phenyl]methylidene]-2-methyl-6-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=Cc2cc(C)c(O)c(C(C)(C)CC(C)(C)C)c2)C=C(C(C)(C)CC(C)(C)C)C1=O |
| InChI | InChI=1S/C31H46O2/c1-20-13-22(16-24(26(20)32)30(9,10)18-28(3,4)5)15-23-14-21(2)27(33)25(17-23)31(11,12)19-29(6,7)8/h13-17,32H,18-19H2,1-12H3 |
| InChIKey | KVMYIMZDMRWMTE-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'} |
|---|