C15H13FN2O3S — CID 54016342
2-(6-fluoro-1,2,3-benzothiadiazole-7-carbonyl)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 54016342) has the molecular formula C15H13FN2O3S and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-(6-fluoro-1,2,3-benzothiadiazole-7-carbonyl)-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-(6-fluoro-1,2,3-benzothiadiazole-7-carbonyl)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54016342 |
| Molecular Formula | C15H13FN2O3S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-(6-fluoro-1,2,3-benzothiadiazole-7-carbonyl)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(=O)c2c(F)ccc3nnsc23)C(=O)C1 |
| InChI | InChI=1S/C15H13FN2O3S/c1-15(2)5-9(19)12(10(20)6-15)13(21)11-7(16)3-4-8-14(11)22-18-17-8/h3-4,12H,5-6H2,1-2H3 |
| InChIKey | KVWWCTNODFWIHZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|