C23H20F3N3O3S — CID 54016468
1-methyl-3-[3-[2-(4-methylphenyl)ethoxymethyl]-1,2-benzothiazol-5-yl]-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 54016468) has the molecular formula C23H20F3N3O3S and a molecular weight of 475.49 g/mol. Its IUPAC name is 1-methyl-3-[3-[2-(4-methylphenyl)ethoxymethyl]-1,2-benzothiazol-5-yl]-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-methyl-3-[3-[2-(4-methylphenyl)ethoxymethyl]-1,2-benzothiazol-5-yl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54016468 |
| Molecular Formula | C23H20F3N3O3S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-methyl-3-[3-[2-(4-methylphenyl)ethoxymethyl]-1,2-benzothiazol-5-yl]-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cc1ccc(CCOCc2nsc3ccc(-n4c(=O)cc(C(F)(F)F)n(C)c4=O)cc23)cc1 |
| InChI | InChI=1S/C23H20F3N3O3S/c1-14-3-5-15(6-4-14)9-10-32-13-18-17-11-16(7-8-19(17)33-27-18)29-21(30)12-20(23(24,25)26)28(2)22(29)31/h3-8,11-12H,9-10,13H2,1-2H3 |
| InChIKey | KVYSOHJEJGFWCJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|