C20H29FO5 — CID 54016522
7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxyocta-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid (PubChem CID 54016522) has the molecular formula C20H29FO5 and a molecular weight of 368.45 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxyocta-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxyocta-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 54016522 |
| Molecular Formula | C20H29FO5 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxyocta-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
| SMILES | CCCC=C(F)[C@H](O)C=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O |
| InChI | InChI=1S/C20H29FO5/c1-2-3-8-16(21)18(23)13-11-14-10-12-17(22)15(14)7-5-4-6-9-19(24)20(25)26/h4-5,8,11,13-15,18-19,23-24H,2-3,6-7,9-10,12H2,1H3,(H,25,26)/t14-,15-,18-,19?/m1/s1 |
| InChIKey | KVZPGGQHOWYILZ-KULOWOMISA-N |
| XLogP | 3.32 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|