About 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol
4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 54016676) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 54016676 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | NCCC1=CC(O)C(O)C=C1 |
| InChI | InChI=1S/C8H13NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,7-8,10-11H,3-4,9H2 |
| InChIKey | KWCIWVCMDMTKSP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol (CID 54016676) is 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol is NCCC1=CC(O)C(O)C=C1.
What is the InChIKey of 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol?
The InChIKey is KWCIWVCMDMTKSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,7-8,10-11H,3-4,9H2.
What are the key properties of 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol?
4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol has a molecular weight of 155.20 g/mol, XLogP of -0.45, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)cyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 54016676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).