C14H23NO3 — CID 54016708
ethyl 2-[(3aR,9aR)-2-oxo-3a,4,5,6,7,8,9,9a-octahydro-3H-cycloocta[b]pyrrol-1-yl]acetate (PubChem CID 54016708) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is ethyl 2-[(3aR,9aR)-2-oxo-3a,4,5,6,7,8,9,9a-octahydro-3H-cycloocta[b]pyrrol-1-yl]acetate.
| Compound Name | ethyl 2-[(3aR,9aR)-2-oxo-3a,4,5,6,7,8,9,9a-octahydro-3H-cycloocta[b]pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 54016708 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethyl 2-[(3aR,9aR)-2-oxo-3a,4,5,6,7,8,9,9a-octahydro-3H-cycloocta[b]pyrrol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C[C@H]2CCCCCC[C@H]21 |
| InChI | InChI=1S/C14H23NO3/c1-2-18-14(17)10-15-12-8-6-4-3-5-7-11(12)9-13(15)16/h11-12H,2-10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | KWCYHKWJMAAJRF-VXGBXAGGSA-N |
| XLogP | 2.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |