About 5H-pyrrolo[1,2-a]quinolin-1-one
5H-pyrrolo[1,2-a]quinolin-1-one (PubChem CID 54016712) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5H-pyrrolo[1,2-a]quinolin-1-one.
Molecular Properties
| Compound Name | 5H-pyrrolo[1,2-a]quinolin-1-one |
| PubChem CID | 54016712 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 5H-pyrrolo[1,2-a]quinolin-1-one |
| SMILES | O=C1C=CC2=CCc3ccccc3N12 |
| InChI | InChI=1S/C12H9NO/c14-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)12/h1-4,6-8H,5H2 |
| InChIKey | KWCZEQFVVOZQLK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5H-pyrrolo[1,2-a]quinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[1,2-a]quinolin-1-one?
The IUPAC name of 5H-pyrrolo[1,2-a]quinolin-1-one (CID 54016712) is 5H-pyrrolo[1,2-a]quinolin-1-one.
What is the SMILES notation for 5H-pyrrolo[1,2-a]quinolin-1-one?
The canonical SMILES for 5H-pyrrolo[1,2-a]quinolin-1-one is O=C1C=CC2=CCc3ccccc3N12.
What is the InChIKey of 5H-pyrrolo[1,2-a]quinolin-1-one?
The InChIKey is KWCZEQFVVOZQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c14-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)12/h1-4,6-8H,5H2.
What are the key properties of 5H-pyrrolo[1,2-a]quinolin-1-one?
5H-pyrrolo[1,2-a]quinolin-1-one has a molecular weight of 183.21 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[1,2-a]quinolin-1-one is sourced from PubChem (CID 54016712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).