C23H34O6 — CID 54017100
(4R,5R)-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 54017100) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is (4R,5R)-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | (4R,5R)-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54017100 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (4R,5R)-2-(6,10,14-trimethylpentadeca-1,5,9,13-tetraen-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | C=C(CCC=C(C)CCC=C(C)CCC=C(C)C)C1O[C@@H](C(=O)O)[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C23H34O6/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)23-28-19(21(24)25)20(29-23)22(26)27/h9,11,13,19-20,23H,5-8,10,12,14H2,1-4H3,(H,24,25)(H,26,27)/t19-,20-/m1/s1 |
| InChIKey | KWJILCRMGDBQDJ-WOJBJXKFSA-N |
| XLogP | 5.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|