About N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide
N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide (PubChem CID 54017336) has the molecular formula C14H14FNO2
and a molecular weight of 247.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide |
| PubChem CID | 54017336 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide |
| SMILES | Cc1oc(C)c(N(C=O)c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C14H14FNO2/c1-9-10(2)18-11(3)14(9)16(8-17)13-6-4-12(15)5-7-13/h4-8H,1-3H3 |
| InChIKey | KWMYHKIGDISYBC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide?
The IUPAC name of N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide (CID 54017336) is N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide.
What is the SMILES notation for N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide?
The canonical SMILES for N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide is Cc1oc(C)c(N(C=O)c2ccc(F)cc2)c1C.
What is the InChIKey of N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide?
The InChIKey is KWMYHKIGDISYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNO2/c1-9-10(2)18-11(3)14(9)16(8-17)13-6-4-12(15)5-7-13/h4-8H,1-3H3.
What are the key properties of N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide?
N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide has a molecular weight of 247.27 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N-(2,4,5-trimethylfuran-3-yl)formamide is sourced from PubChem (CID 54017336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).