C22H44O2S — CID 54017373
1-ethylsulfonyl-3,7,11,15-tetramethylhexadec-2-ene (PubChem CID 54017373) has the molecular formula C22H44O2S and a molecular weight of 372.66 g/mol. Its IUPAC name is 1-ethylsulfonyl-3,7,11,15-tetramethylhexadec-2-ene.
| Compound Name | 1-ethylsulfonyl-3,7,11,15-tetramethylhexadec-2-ene |
|---|---|
| PubChem CID | 54017373 |
| Molecular Formula | C22H44O2S |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | 1-ethylsulfonyl-3,7,11,15-tetramethylhexadec-2-ene |
| SMILES | CCS(=O)(=O)CC=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H44O2S/c1-7-25(23,24)18-17-22(6)16-10-15-21(5)14-9-13-20(4)12-8-11-19(2)3/h17,19-21H,7-16,18H2,1-6H3 |
| InChIKey | KWNPLMDFAQMFRT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|