C23H25N5O3S — CID 54019403
ethyl (3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-7-isocyano-3,5-dihydro-2H-1,4-benzodiazepine-4-sulfonate (PubChem CID 54019403) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is ethyl (3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-7-isocyano-3,5-dihydro-2H-1,4-benzodiazepine-4-sulfonate.
| Compound Name | ethyl (3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-7-isocyano-3,5-dihydro-2H-1,4-benzodiazepine-4-sulfonate |
|---|---|
| PubChem CID | 54019403 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | ethyl (3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-7-isocyano-3,5-dihydro-2H-1,4-benzodiazepine-4-sulfonate |
| SMILES | [C-]#[N+]c1ccc2c(c1)CN(S(=O)(=O)OCC)[C@H](Cc1ccccc1)CN2Cc1cnc[nH]1 |
| InChI | InChI=1S/C23H25N5O3S/c1-3-31-32(29,30)28-14-19-12-20(24-2)9-10-23(19)27(15-21-13-25-17-26-21)16-22(28)11-18-7-5-4-6-8-18/h4-10,12-13,17,22H,3,11,14-16H2,1H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | KXWPWPGCGRQULD-JOCHJYFZSA-N |
| XLogP | 3.68 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|