C21H27F4NO3S — CID 54019615
(4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoic acid (PubChem CID 54019615) has the molecular formula C21H27F4NO3S and a molecular weight of 449.51 g/mol. Its IUPAC name is (4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoic acid.
| Compound Name | (4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoic acid |
|---|---|
| PubChem CID | 54019615 |
| Molecular Formula | C21H27F4NO3S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (4S)-4-(dec-3-enoylamino)-5-(2,3,5,6-tetrafluorophenyl)sulfanylpentanoic acid |
| SMILES | CCCCCCC=CCC(=O)N[C@@H](CCC(=O)O)CSc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C21H27F4NO3S/c1-2-3-4-5-6-7-8-9-17(27)26-14(10-11-18(28)29)13-30-21-19(24)15(22)12-16(23)20(21)25/h7-8,12,14H,2-6,9-11,13H2,1H3,(H,26,27)(H,28,29)/t14-/m0/s1 |
| InChIKey | KYAFVPRMJXRGBP-AWEZNQCLSA-N |
| XLogP | 5.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|