C19H22F3N3O4S — CID 54019617
ethyl 6-(2-aminoethylsulfanylmethyl)-2-methyl-3-nitro-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate (PubChem CID 54019617) has the molecular formula C19H22F3N3O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is ethyl 6-(2-aminoethylsulfanylmethyl)-2-methyl-3-nitro-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 6-(2-aminoethylsulfanylmethyl)-2-methyl-3-nitro-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 54019617 |
| Molecular Formula | C19H22F3N3O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | ethyl 6-(2-aminoethylsulfanylmethyl)-2-methyl-3-nitro-4-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CSCCN)N=C(C)C([N+](=O)[O-])C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H22F3N3O4S/c1-3-29-18(26)16-14(10-30-8-7-23)24-11(2)17(25(27)28)15(16)12-5-4-6-13(9-12)19(20,21)22/h4-6,9,15,17H,3,7-8,10,23H2,1-2H3 |
| InChIKey | KYAGVFXAGBYVFZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|