About 2-decoxy-6-phenylbenzoyl chloride
2-decoxy-6-phenylbenzoyl chloride (PubChem CID 54019687) has the molecular formula C23H29ClO2
and a molecular weight of 372.94 g/mol. Its IUPAC name is 2-decoxy-6-phenylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-decoxy-6-phenylbenzoyl chloride |
| PubChem CID | 54019687 |
| Molecular Formula | C23H29ClO2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2-decoxy-6-phenylbenzoyl chloride |
| SMILES | CCCCCCCCCCOc1cccc(-c2ccccc2)c1C(=O)Cl |
| InChI | InChI=1S/C23H29ClO2/c1-2-3-4-5-6-7-8-12-18-26-21-17-13-16-20(22(21)23(24)25)19-14-10-9-11-15-19/h9-11,13-17H,2-8,12,18H2,1H3 |
| InChIKey | KYBLRGBYMXEVDM-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decoxy-6-phenylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decoxy-6-phenylbenzoyl chloride?
The IUPAC name of 2-decoxy-6-phenylbenzoyl chloride (CID 54019687) is 2-decoxy-6-phenylbenzoyl chloride.
What is the SMILES notation for 2-decoxy-6-phenylbenzoyl chloride?
The canonical SMILES for 2-decoxy-6-phenylbenzoyl chloride is CCCCCCCCCCOc1cccc(-c2ccccc2)c1C(=O)Cl.
What is the InChIKey of 2-decoxy-6-phenylbenzoyl chloride?
The InChIKey is KYBLRGBYMXEVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29ClO2/c1-2-3-4-5-6-7-8-12-18-26-21-17-13-16-20(22(21)23(24)25)19-14-10-9-11-15-19/h9-11,13-17H,2-8,12,18H2,1H3.
What are the key properties of 2-decoxy-6-phenylbenzoyl chloride?
2-decoxy-6-phenylbenzoyl chloride has a molecular weight of 372.94 g/mol, XLogP of 7.25, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decoxy-6-phenylbenzoyl chloride is sourced from PubChem (CID 54019687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).