C25H40O8 — CID 54019742
trans-diethyl (2R,3R)-2-(acetyloxymethyl)-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate (PubChem CID 54019742) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is trans-diethyl (2R,3R)-2-(acetyloxymethyl)-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2R,3R)-2-(acetyloxymethyl)-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 54019742 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | trans-diethyl (2R,3R)-2-(acetyloxymethyl)-3-[3-(oxan-2-yloxy)oct-1-enyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CCCCCC(C=C[C@@H]1[C@@H](COC(C)=O)C1(C(=O)OCC)C(=O)OCC)OC1CCCCO1 |
| InChI | InChI=1S/C25H40O8/c1-5-8-9-12-19(33-22-13-10-11-16-31-22)14-15-20-21(17-32-18(4)26)25(20,23(27)29-6-2)24(28)30-7-3/h14-15,19-22H,5-13,16-17H2,1-4H3/t19?,20-,21-,22?/m1/s1 |
| InChIKey | KYCKSNPDMOCONH-PWAJEDTMSA-N |
| XLogP | 3.96 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|