About dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate
dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate (PubChem CID 54020221) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate |
| PubChem CID | 54020221 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C)C(C)C1 |
| InChI | InChI=1S/C11H18O4/c1-7-5-11(6-8(7)2,9(12)14-3)10(13)15-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | KYKASJGYHIMHKE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate?
The IUPAC name of dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate (CID 54020221) is dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate.
What is the SMILES notation for dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate?
The canonical SMILES for dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate is COC(=O)C1(C(=O)OC)CC(C)C(C)C1.
What is the InChIKey of dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate?
The InChIKey is KYKASJGYHIMHKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-7-5-11(6-8(7)2,9(12)14-3)10(13)15-4/h7-8H,5-6H2,1-4H3.
What are the key properties of dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate?
dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate has a molecular weight of 214.26 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3,4-dimethylcyclopentane-1,1-dicarboxylate is sourced from PubChem (CID 54020221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).