About 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine
4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine (PubChem CID 54020302) has the molecular formula C21H35N5O4
and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine |
| PubChem CID | 54020302 |
| Molecular Formula | C21H35N5O4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine |
| SMILES | COc1c(OC2CCN(C)CC2)nc(N2CCOCC2)nc1OC1CCN(C)CC1 |
| InChI | InChI=1S/C21H35N5O4/c1-24-8-4-16(5-9-24)29-19-18(27-3)20(30-17-6-10-25(2)11-7-17)23-21(22-19)26-12-14-28-15-13-26/h16-17H,4-15H2,1-3H3 |
| InChIKey | KYLLQMQIYIZMQW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine?
The IUPAC name of 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine (CID 54020302) is 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine.
What is the SMILES notation for 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine?
The canonical SMILES for 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine is COc1c(OC2CCN(C)CC2)nc(N2CCOCC2)nc1OC1CCN(C)CC1.
What is the InChIKey of 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine?
The InChIKey is KYLLQMQIYIZMQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35N5O4/c1-24-8-4-16(5-9-24)29-19-18(27-3)20(30-17-6-10-25(2)11-7-17)23-21(22-19)26-12-14-28-15-13-26/h16-17H,4-15H2,1-3H3.
What are the key properties of 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine?
4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine has a molecular weight of 421.54 g/mol, XLogP of 1.27, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-methoxy-4,6-bis[(1-methylpiperidin-4-yl)oxy]pyrimidin-2-yl]morpholine is sourced from PubChem (CID 54020302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).