About (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate
(2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate (PubChem CID 54020618) has the molecular formula C19H18N2O6
and a molecular weight of 370.36 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate |
| PubChem CID | 54020618 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate |
| SMILES | CC1=CC(=O)N(c2ccc(CCCC(=O)On3c(O)ccc3O)cc2)C1=O |
| InChI | InChI=1S/C19H18N2O6/c1-12-11-17(24)20(19(12)26)14-7-5-13(6-8-14)3-2-4-18(25)27-21-15(22)9-10-16(21)23/h5-11,22-23H,2-4H2,1H3 |
| InChIKey | KYRFWTKKALSOPK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate (CID 54020618) is (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate is CC1=CC(=O)N(c2ccc(CCCC(=O)On3c(O)ccc3O)cc2)C1=O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate?
The InChIKey is KYRFWTKKALSOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O6/c1-12-11-17(24)20(19(12)26)14-7-5-13(6-8-14)3-2-4-18(25)27-21-15(22)9-10-16(21)23/h5-11,22-23H,2-4H2,1H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate?
(2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate has a molecular weight of 370.36 g/mol, XLogP of 1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]butanoate is sourced from PubChem (CID 54020618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).