About 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide
3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide (PubChem CID 54020928) has the molecular formula C18H19F2NO2
and a molecular weight of 319.35 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide |
| PubChem CID | 54020928 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide |
| SMILES | CN(C(=O)CC(CCO)c1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H19F2NO2/c1-21(15-5-3-2-4-6-15)18(23)12-14(9-10-22)13-7-8-16(19)17(20)11-13/h2-8,11,14,22H,9-10,12H2,1H3 |
| InChIKey | KYWFUSGZUQABPJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide?
The IUPAC name of 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide (CID 54020928) is 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide.
What is the SMILES notation for 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide?
The canonical SMILES for 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide is CN(C(=O)CC(CCO)c1ccc(F)c(F)c1)c1ccccc1.
What is the InChIKey of 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide?
The InChIKey is KYWFUSGZUQABPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2NO2/c1-21(15-5-3-2-4-6-15)18(23)12-14(9-10-22)13-7-8-16(19)17(20)11-13/h2-8,11,14,22H,9-10,12H2,1H3.
What are the key properties of 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide?
3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide has a molecular weight of 319.35 g/mol, XLogP of 3.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)-5-hydroxy-N-methyl-N-phenylpentanamide is sourced from PubChem (CID 54020928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).