About 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate
2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate (PubChem CID 54021121) has the molecular formula C9H16O4S2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate.
Molecular Properties
| Compound Name | 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate |
| PubChem CID | 54021121 |
| Molecular Formula | C9H16O4S2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate |
| SMILES | CCSCC(OC=O)C(=O)OCCSC |
| InChI | InChI=1S/C9H16O4S2/c1-3-15-6-8(13-7-10)9(11)12-4-5-14-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | KWIXCOWAEBWVFX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate?
The IUPAC name of 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate (CID 54021121) is 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate.
What is the SMILES notation for 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate?
The canonical SMILES for 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate is CCSCC(OC=O)C(=O)OCCSC.
What is the InChIKey of 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate?
The InChIKey is KWIXCOWAEBWVFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4S2/c1-3-15-6-8(13-7-10)9(11)12-4-5-14-2/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate?
2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate has a molecular weight of 252.36 g/mol, XLogP of 1.19, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl 3-ethylsulfanyl-2-formyloxypropanoate is sourced from PubChem (CID 54021121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).