About [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol
[3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol (PubChem CID 54021215) has the molecular formula C7H14O4
and a molecular weight of 162.19 g/mol. Its IUPAC name is [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol.
Molecular Properties
| Compound Name | [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol |
| PubChem CID | 54021215 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol |
| SMILES | CC1(C)C(C(O)O)C1C(O)O |
| InChI | InChI=1S/C7H14O4/c1-7(2)3(5(8)9)4(7)6(10)11/h3-6,8-11H,1-2H3 |
| InChIKey | KZBBFWAZUYUHGB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol?
The IUPAC name of [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol (CID 54021215) is [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol.
What is the SMILES notation for [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol?
The canonical SMILES for [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol is CC1(C)C(C(O)O)C1C(O)O.
What is the InChIKey of [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol?
The InChIKey is KZBBFWAZUYUHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c1-7(2)3(5(8)9)4(7)6(10)11/h3-6,8-11H,1-2H3.
What are the key properties of [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol?
[3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol has a molecular weight of 162.19 g/mol, XLogP of -1.12, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dihydroxymethyl)-2,2-dimethylcyclopropyl]methanediol is sourced from PubChem (CID 54021215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).