C18H15BrCl2O2 — CID 54021558
[4-bromo-3-(4-methylphenyl)but-2-enyl] 2,4-dichlorobenzoate (PubChem CID 54021558) has the molecular formula C18H15BrCl2O2 and a molecular weight of 414.13 g/mol. Its IUPAC name is [4-bromo-3-(4-methylphenyl)but-2-enyl] 2,4-dichlorobenzoate.
| Compound Name | [4-bromo-3-(4-methylphenyl)but-2-enyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 54021558 |
| Molecular Formula | C18H15BrCl2O2 |
| Molecular Weight | 414.13 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | [4-bromo-3-(4-methylphenyl)but-2-enyl] 2,4-dichlorobenzoate |
| SMILES | Cc1ccc(C(=CCOC(=O)c2ccc(Cl)cc2Cl)CBr)cc1 |
| InChI | InChI=1S/C18H15BrCl2O2/c1-12-2-4-13(5-3-12)14(11-19)8-9-23-18(22)16-7-6-15(20)10-17(16)21/h2-8,10H,9,11H2,1H3 |
| InChIKey | KZGPMRKVOBTDRR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.13 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|