C7H14O4S — CID 54021856
(2S,4S)-1-ethylsulfanyl-2,4,5-trihydroxypentan-3-one (PubChem CID 54021856) has the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. Its IUPAC name is (2S,4S)-1-ethylsulfanyl-2,4,5-trihydroxypentan-3-one.
| Compound Name | (2S,4S)-1-ethylsulfanyl-2,4,5-trihydroxypentan-3-one |
|---|---|
| PubChem CID | 54021856 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (2S,4S)-1-ethylsulfanyl-2,4,5-trihydroxypentan-3-one |
| SMILES | CCSC[C@@H](O)C(=O)[C@@H](O)CO |
| InChI | InChI=1S/C7H14O4S/c1-2-12-4-6(10)7(11)5(9)3-8/h5-6,8-10H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | KZMBUTDCLPDBRS-NTSWFWBYSA-N |
| XLogP | -0.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |