About (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide
(2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 54022190) has the molecular formula C16H20N4O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide.
Molecular Properties
| Compound Name | (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide |
| PubChem CID | 54022190 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1c(C)cccc1Oc1nn(C)cc1C |
| InChI | InChI=1S/C16H20N4O3/c1-10-7-6-8-12(23-16-11(2)9-20(4)18-16)13(10)14(19-22-5)15(21)17-3/h6-9H,1-5H3,(H,17,21)/b19-14+ |
| InChIKey | KZRZOZZSUICYMI-XMHGGMMESA-N |
| XLogP | 1.93 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide?
The IUPAC name of (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide (CID 54022190) is (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide.
What is the SMILES notation for (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide?
The canonical SMILES for (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide is CNC(=O)/C(=N/OC)c1c(C)cccc1Oc1nn(C)cc1C.
What is the InChIKey of (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide?
The InChIKey is KZRZOZZSUICYMI-XMHGGMMESA-N. The full InChI is InChI=1S/C16H20N4O3/c1-10-7-6-8-12(23-16-11(2)9-20(4)18-16)13(10)14(19-22-5)15(21)17-3/h6-9H,1-5H3,(H,17,21)/b19-14+.
What are the key properties of (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide?
(2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide has a molecular weight of 316.36 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[2-(1,4-dimethylpyrazol-3-yl)oxy-6-methylphenyl]-2-methoxyimino-N-methylacetamide is sourced from PubChem (CID 54022190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).