C16H15NO3 — CID 54022541
1-[4-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyloxy)butyl]pyrrole-2,5-dione (PubChem CID 54022541) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-[4-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyloxy)butyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyloxy)butyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 54022541 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-[4-(7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyloxy)butyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCOC1=Cc2ccccc21 |
| InChI | InChI=1S/C16H15NO3/c18-15-7-8-16(19)17(15)9-3-4-10-20-14-11-12-5-1-2-6-13(12)14/h1-2,5-8,11H,3-4,9-10H2 |
| InChIKey | KZXVHVOUOBXVEY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|